![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 04.jpg | 2019-11-04 12:13 | 28K | |
| 04a.jpg | 2019-11-04 12:16 | 20K | |
| 04b.jpg | 2019-02-09 10:50 | 54K | |
| 04c.jpg | 2019-02-09 11:23 | 44K | |
| 17b.jpg | 2019-10-19 14:56 | 104K | |
| 25f.jpg | 2019-07-29 11:31 | 33K | |
| 29.jpg | 2019-10-29 16:18 | 305K | |
| Call-for-Student-Abstracts-ieee2019.jpg | 2019-10-03 13:45 | 851K | |
| Exam.png | 2019-06-24 10:32 | 143K | |
| The organizational structure of the library.jpg | 2019-10-09 16:02 | 250K | |
| first-conference-of-children-s-university.jpg | 2019-02-03 19:43 | 76K | |
| lib-papers/ | 2022-03-02 09:52 | - | |
| lib.PNG | 2019-10-09 19:52 | 23K | |
| library/ | 2022-03-02 09:52 | - | |
| library_cpc/ | 2022-03-02 09:52 | - | |
| midc3/ | 2022-03-02 09:52 | - | |
| saweras.jpg | 2019-02-03 18:34 | 18K | |
| scan0005.jpg | 2019-11-19 13:16 | 2.5M | |
