![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 1111.doc | 2016-03-22 11:52 | 183K | |
![[DIR]](/icons/folder.gif) | 2017-2018/ | 2021-08-03 15:07 | - | |
| 2021/ | 2022-06-26 10:09 | - | |
![[ ]](/icons/layout.gif) | 3107.pdf | 2018-08-01 10:41 | 1.0M | |
| 170711/ | 2021-08-03 15:07 | - | |
| 170824/ | 2021-08-03 15:07 | - | |
| 190929/ | 2021-08-03 15:07 | - | |
| Chemical Detergents Report.pdf | 2018-11-07 11:41 | 1.3M | |
| Child University 2018.pdf | 2018-08-16 12:49 | 1.3M | |
| English2022/ | 2022-03-27 09:41 | - | |
| English course.pdf | 2018-09-22 12:52 | 1.8M | |
| Follow-up graduates2.pdf | 2018-03-01 10:21 | 3.2M | |
| Graduate_Data.pdf | 2016-03-16 08:52 | 148K | |
| Journal of Environmental Science.pdf | 2016-08-24 11:23 | 2.9M | |
| Manufacture of soap.pdf | 2018-07-29 11:51 | 1.3M | |
| Protocols.pdf | 2022-01-05 09:03 | 764K | |
| Water Company2018.pdf | 2018-07-29 11:46 | 1.0M | |
| annual_report_2020-2021.pdf | 2022-01-05 09:48 | 22M | |
| april2017.pdf | 2017-06-12 11:07 | 301K | |
| dec2016.pdf | 2017-06-12 11:07 | 345K | |
| feb2017.pdf | 2017-06-12 11:07 | 345K | |
| forum-report-2017/ | 2021-08-03 15:07 | - | |
| graduates-tips.pdf | 2017-06-18 12:07 | 329K | |
| hfeb2016.pdf | 2016-10-31 10:09 | 380K | |
| h may2016.pdf | 2016-10-31 10:09 | 513K | |
| h oct2015.pdf | 2016-10-31 10:01 | 714K | |
| h oct2016.pdf | 2016-10-31 10:09 | 708K | |
| h sept 2015.pdf | 2016-10-31 10:08 | 519K | |
| jun2017.pdf | 2017-06-12 11:07 | 273K | |
| may2017.pdf | 2017-06-12 11:07 | 271K | |
| mining-conference.pdf | 2018-03-26 08:30 | 1.0M | |
| nov2016.pdf | 2017-06-12 11:06 | 317K | |
| oct-may18.pdf | 2018-05-28 10:48 | 490K | |
| oct2016.pdf | 2017-06-12 11:09 | 376K | |
| postgraduate2017/ | 2021-08-03 15:07 | - | |
| postgraduate2018.pdf | 2018-05-14 12:06 | 2.9M | |
| postgraduate_2021.pdf | 2022-01-05 09:26 | 14M | |
| report ICDL.pdf | 2018-11-07 11:41 | 2.0M | |
| seifeeco2.pdf | 2020-01-01 12:12 | 805K | |
| sep2016.pdf | 2017-06-12 11:09 | 450K | |
| sugar-company/ | 2021-08-03 15:07 | - | |
|
|---|