![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| write.pdf | 2020-09-16 09:50 | 165K | |
| workshop/ | 2023-11-08 09:27 | - | |
| virsual/ | 2021-09-12 09:46 | - | |
| video/ | 2022-07-23 12:56 | - | |
| units/ | 2021-07-06 11:07 | - | |
| training3.pdf | 2020-09-16 09:50 | 621K | |
| training2.pdf | 2020-09-16 09:50 | 583K | |
| training/ | 2020-09-16 09:50 | - | |
| test.pdf | 2020-09-16 09:50 | 2.0M | |
| test (2).pdf | 2020-09-16 09:50 | 1.9M | |
| team-workw.pdf | 2020-09-16 09:50 | 125K | |
| tables/ | 2023-02-08 11:14 | - | |
| summer training for college students.pdf | 2020-09-16 09:50 | 2.6M | |
| subjecte.pdf | 2020-09-16 09:50 | 247K | |
| subject.pdf | 2020-09-16 09:50 | 253K | |
| student guide.pdf | 2020-09-16 09:50 | 126K | |
| student-activities/ | 2020-09-16 09:50 | - | |
| structure.pdf | 2020-09-16 09:50 | 48K | |
| staff1.pdf | 2023-03-08 08:02 | 228K | |
| services/ | 2021-09-09 15:03 | - | |
| self-study.pdf | 2020-09-16 09:50 | 19M | |
| sectors/ | 2021-06-20 12:59 | - | |
| search.pdf | 2020-09-16 09:50 | 276K | |
| scientific-content-arabic.pdf | 2021-05-31 11:22 | 5.4M | |
| scan0052.pdf | 2020-09-16 09:50 | 8.8M | |
| scan0042.pdf | 2020-09-16 09:50 | 1.1M | |
| scan0037.pdf | 2020-09-16 09:50 | 887K | |
| scan0031.pdf | 2020-09-16 09:50 | 1.1M | |
| scan0026.pdf | 2020-09-16 09:50 | 2.2M | |
| scan0024(1).pdf | 2020-09-16 09:50 | 1.8M | |
| scan0023.pdf | 2020-09-16 09:50 | 530K | |
| scan0023(1).pdf | 2020-09-16 09:50 | 1.0M | |
| scan0022.pdf | 2020-09-16 09:50 | 2.3M | |
| scan0004(1).pdf | 2020-09-16 09:50 | 2.3M | |
| safty1.pdf | 2020-09-16 09:50 | 357K | |
| safty.pdf | 2020-09-16 09:50 | 1.1M | |
| safety.pdf | 2020-09-16 09:50 | 480K | |
| rules/ | 2022-08-25 11:31 | - | |
| rules-intell-prog-new.pdf | 2020-09-16 09:50 | 12M | |
| results/ | 2023-11-27 18:59 | - | |
| result/ | 2023-04-12 11:53 | - | |
| researches.pdf | 2020-09-16 09:50 | 274K | |
| research/ | 2024-03-24 10:51 | - | |
| report.pdf | 2020-09-16 09:50 | 430K | |
| regions.pdf | 2020-09-16 09:50 | 69K | |
| promotion_rules.pdf | 2020-09-16 09:50 | 3.1M | |
| projects/ | 2022-10-27 12:39 | - | |
| product-program.pdf | 2020-09-16 09:50 | 3.0M | |
| prochor/ | 2023-03-01 11:04 | - | |
| procedures.pdf | 2020-09-16 09:50 | 256K | |
| power-mechanic/ | 2020-09-16 09:50 | - | |
| post-graduate/ | 2020-09-16 09:50 | - | |
| plan2013.pdf | 2020-09-16 09:50 | 827K | |
| plan.pdf | 2020-09-16 09:50 | 294K | |
| phd.pdf | 2020-09-16 09:50 | 147K | |
| pdfenglish/ | 2020-09-16 09:50 | - | |
| party.pdf | 2020-09-16 09:50 | 347K | |
| orglow.pdf | 2020-09-16 09:50 | 1.6M | |
| old.pdf | 2021-05-31 11:22 | 805K | |
| new student.pdf | 2020-09-16 09:50 | 304K | |
| news_2141664511.pdf | 2020-09-16 09:50 | 133K | |
| news_2118658639.pdf | 2020-09-16 09:50 | 106K | |
| news_2008188981.pdf | 2020-09-16 09:50 | 17M | |
| news_1991093380.pdf | 2020-09-16 09:50 | 173K | |
| news_1944235819.pdf | 2020-09-16 09:50 | 399K | |
| news_1929871703.pdf | 2020-09-16 09:50 | 259K | |
| news_1601652389.pdf | 2020-09-16 09:50 | 875K | |
| news_1517876224.pdf | 2020-09-16 09:50 | 2.0M | |
| news_1482436774.pdf | 2020-09-16 09:50 | 870K | |
| news_1350441445.pdf | 2020-09-16 09:50 | 635K | |
| news_1297704620.pdf | 2020-09-16 09:50 | 280K | |
| news_1286486704.pdf | 2020-09-16 09:50 | 1.0M | |
| news_1226896051.pdf | 2020-09-16 09:50 | 328K | |
| news_1220964404.pdf | 2020-09-16 09:50 | 139K | |
| news_1176934905.pdf | 2020-09-16 09:50 | 260K | |
| news_1176934905 (1).pdf | 2020-09-16 09:50 | 260K | |
| news_1147392552.pdf | 2020-09-16 09:50 | 278K | |
| news_1117923378.pdf | 2020-09-16 09:50 | 4.6M | |
| news_1016687522.pdf | 2020-09-16 09:50 | 1.5M | |
| news_966230401.pdf | 2020-09-16 09:50 | 97K | |
| news_770289190.pdf | 2020-09-16 09:50 | 730K | |
| news_757471144.pdf | 2020-09-16 09:50 | 17M | |
| news_743305071.pdf | 2020-09-16 09:50 | 534K | |
| news_677450144.pdf | 2020-09-16 09:50 | 273K | |
| news_615435998.pdf | 2020-09-16 09:50 | 17M | |
| news_594988642.pdf | 2020-09-16 09:50 | 3.2M | |
| news_539392659.pdf | 2020-09-16 09:50 | 324K | |
| news_404258250.pdf | 2020-09-16 09:50 | 121K | |
| news_341277727.pdf | 2020-09-16 09:50 | 7.7M | |
| news_249698877.pdf | 2020-09-16 09:50 | 46K | |
| news_202483433.pdf | 2020-09-16 09:50 | 1.9M | |
| news_186509254 1.pdf | 2020-09-16 09:50 | 2.0M | |
| news_186509254.pdf | 2020-09-16 09:50 | 2.0M | |
| news_186509254 (1).pdf | 2020-09-16 09:50 | 2.0M | |
| news_114577923.pdf | 2020-09-16 09:50 | 273K | |
| news_88211774.pdf | 2020-09-16 09:50 | 2.6M | |
| news_34.pdf | 2020-09-16 09:50 | 7.7M | |
| news/ | 2022-07-25 12:36 | - | |
| new2016/ | 2020-09-16 09:50 | - | |
| new.pdf | 2020-09-16 09:50 | 54K | |
| new-programs/ | 2024-08-19 08:11 | - | |
| networking.pdf | 2020-09-16 09:50 | 341K | |
| name.pdf | 2020-09-16 09:50 | 208K | |
| name(1).pdf | 2020-09-16 09:50 | 281K | |
| mission.pdf | 2020-09-16 09:50 | 601K | |
| majesteer.pdf | 2020-09-16 09:50 | 575K | |
| maj3.pdf | 2020-09-16 09:50 | 519K | |
| maj1.pdf | 2020-09-16 09:50 | 430K | |
| main/ | 2025-01-09 12:32 | - | |
| main-n/ | 2023-11-07 11:08 | - | |
| magazine/ | 2023-08-31 19:44 | - | |
| logo_1874351517.pdf | 2020-09-16 09:50 | 57K | |
| logo_713465158.pdf | 2020-09-16 09:50 | 1.4M | |
| logo_713465158(1).pdf | 2020-09-16 09:50 | 1.4M | |
| logo_439401354.pdf | 2020-09-16 09:50 | 192K | |
| library/ | 2023-08-31 09:39 | - | |
| lib1.pdf | 2020-09-16 09:50 | 286K | |
| legan2.pdf | 2020-09-16 09:50 | 458K | |
| legan1.pdf | 2020-09-16 09:50 | 459K | |
| learnsection/ | 2020-09-16 09:50 | - | |
| learning-strategy.pdf | 2020-09-16 09:50 | 195K | |
| layout.gif | 2020-09-16 09:50 | 276 | |
| lawof3amlinbedawla.pdf | 2020-09-16 09:50 | 1.6M | |
| law2002.pdf | 2020-09-16 09:50 | 373K | |
| laureatesawards.pdf | 2020-09-16 09:50 | 126K | |
| labs/ | 2023-11-08 09:39 | - | |
| lab.pdf | 2020-09-16 09:50 | 1.4M | |
| international_students/ | 2025-03-05 11:26 | - | |
| internalrules.pdf | 2020-09-16 09:50 | 648K | |
| int-researches.pdf | 2020-09-16 09:50 | 1.3M | |
| index.html | 2020-09-16 09:50 | 47 | |
| highstudy/ | 2023-12-03 09:50 | - | |
| group_3.pdf | 2020-09-16 09:50 | 264K | |
| group_2.pdf | 2020-09-16 09:50 | 297K | |
| group_1.pdf | 2020-09-16 09:50 | 256K | |
| graduates/ | 2020-12-08 12:54 | - | |
| gawda/ | 2022-09-20 11:09 | - | |
| gawda-new/ | 2025-01-09 13:02 | - | |
| fonseca_NCSA.pdf | 2020-09-16 09:50 | 49K | |
| exams/ | 2024-08-14 07:59 | - | |
| exam-rule.pdf | 2020-09-16 09:50 | 3.6M | |
| ethicsofscientificresearch.pdf | 2020-09-16 09:50 | 409K | |
| enviroment/ | 2020-09-16 09:50 | - | |
| engresearch.pdf | 2020-09-16 09:50 | 1.3M | |
| eng research.pdf | 2020-09-16 09:50 | 1.3M | |
| energy/ | 2020-09-16 09:50 | - | |
| e_geosemantic_web.pdf | 2020-09-16 09:50 | 85K | |
| e2023/ | 2023-09-03 11:11 | - | |
| deplom.pdf | 2020-09-16 09:50 | 756K | |
| department/ | 2020-12-24 13:38 | - | |
| decisions/ | 2020-09-16 09:50 | - | |
| datast.pdf | 2020-09-16 09:50 | 239K | |
| dat.pdf | 2020-09-16 09:50 | 322K | |
| dalil.pdf | 2020-09-16 09:50 | 3.5M | |
| daleel.pdf | 2020-09-16 09:50 | 6.2M | |
| courses.pdf | 2020-09-16 09:50 | 1.0M | |
| content-n1.pdf | 2023-01-14 16:48 | 4.6M | |
| computerdept/ | 2020-09-16 09:50 | - | |
| computerdept./ | 2020-09-16 09:50 | - | |
| comTT.pdf | 2020-09-16 09:50 | 134K | |
| centers/ | 2021-01-19 08:49 | - | |
| camara_etAl Andrew Frank Book ABSTRACT.pdf | 2020-09-16 09:50 | 12K | |
| blank.gif | 2020-09-16 09:50 | 148 | |
| binder1.pdf | 2023-05-31 11:46 | 373K | |
| back.gif | 2020-09-16 09:50 | 216 | |
| autostudy.pdf | 2020-09-16 09:50 | 1.9M | |
| auto biography.pdf | 2020-09-16 09:50 | 1.3M | |
| auto-iography.pdf | 2020-09-16 09:50 | 1.3M | |
| adver/ | 2020-09-16 09:50 | - | |
| administrative-procedures/ | 2024-08-11 08:10 | - | |
| activities/ | 2024-01-15 13:07 | - | |
| about.pdf | 2020-09-16 09:50 | 3.0M | |
| a2024-2025/ | 2025-03-27 10:35 | - | |
| a2023/ | 2025-02-24 19:48 | - | |
| Transfer of medical management.pdf | 2020-09-16 09:50 | 16K | |
| The ethicsofscientificresearch.pdf | 2020-09-16 09:50 | 409K | |
| Student_forms/ | 2022-07-17 12:51 | - | |
| Site Link.txt | 2020-09-16 09:50 | 109 | |
| SDI Sustainability and GIScience DAVIS FONSECA CAMARA ABSTRACT.pdf | 2020-09-16 09:50 | 170K | |
| Projects.pdf | 2020-09-16 09:50 | 2.6M | |
| Newsletter_12_-_FINAL.pdf | 2020-09-16 09:50 | 1.7M | |
| Li_Fonseca_SCC_preprint.pdf | 2020-09-16 09:50 | 740K | |
| Li_Fonseca_SCC_2006_Abstract.pdf | 2020-09-16 09:50 | 76K | |
| Fonseca et al IConference 2010.pdf | 2020-09-16 09:50 | 39K | |
| Fonseca_TGIS_2002.pdf | 2020-09-16 09:50 | 352K | |
| Fonseca_SCC_2006_preprint.pdf | 2020-09-16 09:50 | 80K | |
| Fonseca_Rodriguez_Editorial_preprint.pdf | 2020-09-16 09:50 | 17K | |
| Fonseca_Ontology_double_role_Abstract.pdf | 2020-09-16 09:50 | 474K | |
| Fonseca_Ontologies_double_role_JASIST_2006.pdf | 2020-09-16 09:50 | 474K | |
| Fonseca_Martin_Ontologies_and_Schemas_Abstract.pdf | 2020-09-16 09:50 | 463K | |
| Fonseca_Martin_Newspeak_Pre_ICIS_04.pdf | 2020-09-16 09:50 | 63K | |
| Fonseca_Martin_ICIS_05_Abstract.pdf | 2020-09-16 09:50 | 61K | |
| Fonseca_Jasist_2005.pdf | 2020-09-16 09:50 | 131K | |
| Fonseca_JASIST_2006_abstract.pdf | 2020-09-16 09:50 | 3.8K | |
| Fonseca_GEOINFORMATICA_2003.pdf | 2020-09-16 09:50 | 245K | |
| Fonseca_CEUS_2000.pdf | 2020-09-16 09:50 | 125K | |
| Fonseca_AMAI_2002.pdf | 2020-09-16 09:50 | 408K | |
| Fonseca_AICOM_2004.pdf | 2020-09-16 09:50 | 108K | |
| Fonseca Martin KMRP 2009 ABSTRACT.pdf | 2020-09-16 09:50 | 9.4K | |
| FonsecaFT2001 PhD Thesis.pdf | 2020-09-16 09:50 | 939K | |
| FonsecaDavisCamara ESIN 2009 PREPRINT.pdf | 2020-09-16 09:50 | 32K | |
| FONSECA et Al_Semantic pixel ABSTRACT.pdf | 2020-09-16 09:50 | 18K | |
| Diploma, master and PHD.pdf | 2020-09-16 09:50 | 401K | |
| Davis_Fonseca_Geoinformatica_2007.pdf | 2020-09-16 09:50 | 112K | |
| DavisFonseca_ITD_2006_abstract.pdf | 2020-09-16 09:50 | 78K | |
| DavisFonsecaCamara GDP2.pdf | 2020-09-16 09:50 | 82K | |
| Camara_Fonseca_abstract_ITD_2006.pdf | 2020-09-16 09:50 | 74K | |
| Camara_Fonseca_JASIST_2006.pdf | 2020-09-16 09:50 | 79K | |
| Binder1.pdf | 2020-09-16 09:50 | 1.2M | |
| AllProjects.pdf | 2020-09-16 09:50 | 454K | |
| Academic_standards.pdf | 2020-09-16 09:50 | 872K | |
| 2023-2024/ | 2024-12-02 10:07 | - | |
| 2022/ | 2023-01-02 09:23 | - | |
| 2021/ | 2023-11-07 09:38 | - | |
| 2019-2020/ | 2021-01-04 12:38 | - | |
| 2018/ | 2020-10-01 12:46 | - | |
| 2018-2019/ | 2020-09-16 09:50 | - | |
| 2017/ | 2020-09-16 09:50 | - | |
| 2016/ | 2020-09-16 09:50 | - | |
| الهيكل التنظيمي لقطاع المعامل.pdf | 2020-09-16 09:50 | 48K | |